Question 1

In which of the following solutions would silver(I)phosphate,Ag₃PO₄,be least soluble?

Accepted Answer

Silver(I) phosphate, Ag3PO4, would be least soluble in a solution containing Ag+ ions due to the common ion effect. Option B, 0.10 M AgNO3, provides Ag+ ions, which would decrease the solubility of Ag3PO4 by shifting the dissolution equilibrium towards the solid phase.

Question 2

What is the minimum mass of Na₂CO₃ (molar mass = 105.990 g/mol)that must be added to 43.4 mL of a 1.0 × 10^-4 M AgNO₃ solution in order for precipitation to occur? The K_sp of Ag₂CO₃ is 8.6 × 10^-12.Assume no volume change occurs upon addition of Na₂CO₃.

Accepted Answer

The answer of What is the minimum mass of Na₂CO₃...

Question 3

Given the following equilibrium constants, Zn4IO₃)₂ K_sp = Zn(NH₃)₄²⁺ K_f = determine K for the dissolution of the sparingly soluble salt Zn(IO₃)₂ in aqueous ammonia (shown below). Zn(IO₃)₂(s)+ 4NH₃(aq)⇌ Zn(NH₃)₄²⁺(aq)+ 2IO₃^-(aq)

Accepted Answer

The answer of Given the following equilibrium constants, Zn4IO₃)₂ K_sp...

Question 4

Two important biological buffer systems control pH in the range of 6.9 to 7.4.These buffer systems are H₂CO₃/HCO₃^- and _____.

Accepted Answer

The answer of Two important biological buffer systems control pH...

Question 5

What is the molar solubility of Mn(OH)₂(s)in a solution that is buffered at pH 8.00 at 25 °C? The K_sp of Mn(OH)₂ is 1.9 × 10^-13 at 25 °C.

Accepted Answer

The answer of What is the molar solubility of Mn(OH)₂(s)in...

Question 6

If the ratio of acid to base in a buffer is increased by a factor of 10,the buffer pH decreases by ________.

Accepted Answer

The answer of If the ratio of acid to base...

Question 7

A 5.0 × 10^-4 M solution of MnSO₄ is gradually made more basic by adding NaOH.At what pH will manganese(II)hydroxide begin to precipitate? The K_sp of Mn(OH)₂ is 2.0 × 10^-13 and K_w = 1.01 × 10^-14.

Accepted Answer

The answer of A 5.0 × 10^-4 M solution of...

Question 8

Consider the reaction Cu²⁺(aq)+ 4 NH₃(aq) Cu(NH₃)₄²⁺(aq) K_f = 2.1 × 10¹³ If the K_sp for Cu(OH)₂ is 2.2 × 10^-20,what is the value of the equilibrium constant,K,for the reaction below? Cu(NH₃)₄²⁺(aq)+ 2 OH^-(aq) Cu(OH)₂(s)+ 4 NH₃(aq)

Accepted Answer

The answer of Consider the reaction Cu²⁺(aq)+ 4 NH₃(aq) ...

Question 9

Given the two equilibria below, Ag(NH₃)₂⁺(aq) Ag⁺(aq)+ 2NH₃(aq); K_d = 5.9 × 10^-8 AgCN(s) Ag⁺(aq)+ CN−(aq); K_sp = what is K for the following equilibrium? AgCN(s)+ 2NH₃(aq) Ag(NH₃)₂⁺(aq)+ CN^-(aq)

Accepted Answer

The answer of Given the two equilibria below, Ag(NH₃)₂⁺(aq) ...

Question 10

What is the concentration of Cd²⁺(aq)in a mixture of 0.014 mol Cd(NO₃)₂ and 1.0 mol NH₃ diluted to 1.00 L? For Cd(NH₃)₄²⁺,K_f = 1.0 × 10⁷.

Accepted Answer

Firstly, we need to write the chemical equation and calculate the initial concentrations of CdS1U1P12+S1S1P0 and S1S1P0 in the solution before any reaction occurs.

Cd(NHS1U1B13S1U1B0)S1U1B12S1U1B0 + S1U1B1U1P0 → CdS1U1P12+S1S1P0 + NHS1U1B13S1U1B0

Initial moles of Cd(NHS1U1B13S1U1B0)S1U1B12S1U1B0 = 0.014 mol
Initial moles of NHS1U1B13S1U1B0 = 1.0 mol
Initial moles of CdS1U1P12+S1S1P0 = 0 mol
Initial moles of S1S1P0 = 0 mol

Total volume of solution = 1.00 L

Therefore, the initial concentration of CdS1U1P12+S1S1P0 = 0 M and the initial concentration of S1S1P0 = 0 M.

Next, we need to determine which species is the limiting reagent. This can be done by comparing the initial moles of Cd(NHS1U1B13S1U1B0)S1U1B12S1U1B0 and S1U1B1U1P0.

Initial moles of Cd(NHS1U1B13S1U1B0)S1U1B12S1U1B0 = 0.014 mol
Initial moles of S1U1B1U1P0 = 1.0 mol

Since there is an excess of S1U1B1U1P0, Cd(NHS1U1B13S1U1B0)S1U1B12S1U1B0 is the limiting reagent.

Using stoichiometry, we can calculate the moles of CdS1U1P12+S1S1P0 formed from the reaction between Cd(NHS1U1B13S1U1B0)S1U1B12S1U1B0 and S1U1B1U1P0.

Moles of Cd(NHS1U1B13S1U1B0)S1U1B12S1U1B0 = 0.014 mol
Moles of CdS1U1P12+S1S1P0 formed = 0.014 mol × 1 mol CdS1U1P12+S1S1P0 / 1 mol Cd(NHS1U1B13S1U1B0)S1U1B12S1U1B0 = 0.014 mol

Therefore, the final moles of CdS1U1P12+S1S1P0 = 0.014 mol and the final moles of S1S1P0 = 1.0 mol - 0.014 mol = 0.986 mol.

Using the total volume of the solution, we can calculate the final concentrations of CdS1U1P12+S1S1P0 and S1S1P0.

Concentration of CdS1U1P12+S1S1P0 = 0.014 mol / 1.00 L = 1.4 × 10S1U1P1-2S1S1P0 M
Concentration of S1S1P0 = 0.986 mol / 1.00 L = 9.86 × 10S1U1P0S1S1P0 M

Finally, we can use the equilibrium constant to calculate the concentration of CdS1U1P12+S1S1P0 in the equilibrium mixture.

KS1U1B1fS1U1B0 = [CdS1U1P12+S1S1P0][S1S1P0] / [Cd(NHS1U1B13S1U1B0)S1U1B12S1U1B0][S1U1B1U1P0]

[CdS1U1P12+S1S1P0] = KS1U1B1fS1U1B0[Cd(NHS1U1B13S1U1B0)S1U1B12S1U1B0][S1U1B1U1P0] / [S1S1P0]

[CdS1U1P12+S1S1P0] = (1.0 × 10S1U1P17S1S1P0)(0.014 mol / 1.00 L)(9.86 × 10S1U1P0S1S1P0 mol / 1.00 L) / (0.986 mol / 1.00 L)

[CdS1U1P12+S1S1P0] = 1.8 × 10S1U1P1-9S1S1P0 M

Therefore, the best choice is C.

Question 11

Suppose 50.00 mL of 2.0 × 10^-5 M Fe(NO₃)₃ is added to 50.00 mL of 2.0 ×10^-4 M KIO₃.Which of the following statements is true? For Fe(IO₃)₃,K_sp = 1.0 × 10^-14.

Accepted Answer

The answer of Suppose 50.00 mL of 2.0 × 10^-5...

Question 12

The concentration of Pb²⁺ in an aqueous solution is 5.5 × 10^-3 M.What concentration of SO₄^2- is required to begin precipitating PbSO₄? The K_sp of PbSO₄ is 2.5 × 10^-8.

Accepted Answer

The Ksp of PbSO4 is given as 2.5 × 10^-8. To find the concentration of SO4^2- required to begin precipitating PbSO4, we use the formula Ksp = [Pb^2+][SO4^2-]. Given [Pb^2+] = 5.5 × 10^-3 M, we rearrange the formula to find [SO4^2-] = Ksp / [Pb^2+] = (2.5 × 10^-8) / (5.5 × 10^-3) = 4.5 × 10^-6 M.

Question 13

An aqueous solution contains 0.010 M bromide ion (Br^-)and 0.010 M iodide ion (I^-).If silver ions (Ag⁺)are added to the solution until silver bromide just begins to precipitate,what are the concentrations of silver ions and iodide ions? (K_sp of AgBr = 5.4 × 10^-13 and K_sp of AgI = 8.5 × 10^-17)

Accepted Answer

The precipitation reaction is:

Ag+ + Br- → AgBr (Ksp = 5.4 × 10^-13)

At the point where AgBr just begins to precipitate, the concentrations of Ag+ and Br- in the solution are equal to the solubility product (Ksp) of AgBr.

So, [Ag+] = [Br-] = sqrt(Ksp(AgBr)) = sqrt(5.4 × 10^-13) = 7.35 × 10^-7 M

The remaining iodide ion concentration is given by:

[I-] = [I-]initial - [Ag+] = 0.010 - 7.35 × 10^-7 = 0.010 - 0.000000735 = 0.009999265 M

Now, check the solubility product of AgI:

Ag+ + I- → AgI (Ksp = 8.5 × 10^-17)

If [I-] = 0.009999265 M, then:

Ksp(AgI) = [Ag+][I-] = (7.35 × 10^-7)(0.009999265) = 7.349 × 10^-12

This value is much smaller than the Ksp of AgI, so there is no precipitation of AgI. Therefore, the concentration of iodide ions remains at 0.009999265 M.

So, the final concentrations are:

[Ag+] = 7.35 × 10^-7 M
[I-] = 0.009999265 M

Therefore, the best choice is C.

Question 14

Given the following reactions, AgBr(s) Ag⁺(aq)+ Br^-(aq) K_sp = 5.4 × 10^-13 Ag⁺(aq)+ 2 CN^-(aq) Ag(CN)₂^-(aq) K_f = 1.2 × 10²¹ Determine the equilibrium constant for the reaction below. AgBr(s)+ 2 CN^-(aq) Ag(CN)₂^-(aq)+ Br^-(aq)

Accepted Answer

The answer of Given the following reactions, AgBr(s) Ag⁺(aq)+...

Question 15

Calculate the molar concentration of uncomplexed Zn²⁺(aq)in a solution that contains 0.17 M Zn(NH₃)₄²⁺ and 0.3775 M NH₃ at equilibrium.K_f for Zn(NH₃)₄²⁺ is .

Accepted Answer

The answer of Calculate the molar concentration of uncomplexed Zn²⁺(aq)in...

Question 16

What is the value of the dissociation constant,K_dissociation,for the complex ion Zn(NH₃)₄²⁺? (K_f = 2.9 × 10⁹)

Accepted Answer

The dissociation constant (K_dissociation) is the inverse of the formation constant (K_f). Therefore, K_dissociation = 1 / K_f = 1 / (2.9 × 10^9) = 3.4 × 10^-10.

Question 17

If 500 mL of 1.4 × 10^-6 M AgNO₃ is mixed with 500 mL of 1.4 × 10^-6 M NaBr,what will occur? For AgBr,K_sp = 5 × 10^-13.

Accepted Answer

The answer of If 500 mL of 1.4 × 10^-6...

Question 18

What is the maximum hydroxide-ion concentration that a 0.019 M MgCl₂ solution could have without causing the precipitation of Mg(OH)₂? For Mg(OH)₂,K_sp = 1.8 × 10^-11.

Accepted Answer

The solubility product expression for Mg(OH)₂ is Ksp = [Mg²⁺][OH⁻]². Given Ksp = 1.8 × 10⁻¹¹ and [Mg²⁺] = 0.019 M, solve for [OH⁻]: [OH⁻] = √(Ksp / [Mg²⁺]) = √(1.8 × 10⁻¹¹ / 0.019) = 3.1 × 10⁻⁵ M.

Question 19

For a monoprotic acid titration,the _____ in a titration is the point where number of moles of a strong base added equals the number of moles of an acid initially present.

Accepted Answer

The answer of For a monoprotic acid titration,the _____ in...

Question 20

What is the minimum concentration of Cd²⁺ required to begin precipitating Cd(OH)₂(s)in a solution buffered at pH 10.83? The K_sp of Cd(OH)₂ is 5.3 × 10^-15 and K_w = 1.01 × 10^-14.

Accepted Answer

The answer of What is the minimum concentration of Cd²⁺...

Quiz 17: Principles of Chemical Reactivity: Other Aspects of Aqueous Equilibria

In which of the following solutions would silver(I) phosphate,Ag₃PO₄,be least soluble?

What is the minimum mass of Na₂CO₃ (molar mass = 105.990 g/mol) that must be added to 43.4 mL of a 1.0 × 10^-4 M AgNO₃ solution in order for precipitation to occur? The K_sp of Ag₂CO₃ is 8.6 × 10^-12.Assume no volume change occurs upon addition of Na₂CO₃.

Given the following equilibrium constants, Zn4IO₃) ₂ K_sp = Zn(NH₃) ₄²⁺ K_f = determine K for the dissolution of the sparingly soluble salt Zn(IO₃) ₂ in aqueous ammonia (shown below) . Zn(IO₃) ₂(s) + 4NH₃(aq) ⇌ Zn(NH₃) ₄²⁺(aq) + 2IO₃^-(aq)

Two important biological buffer systems control pH in the range of 6.9 to 7.4.These buffer systems are H₂CO₃/HCO₃^- and _____.

What is the molar solubility of Mn(OH) ₂(s) in a solution that is buffered at pH 8.00 at 25 °C? The K_sp of Mn(OH) ₂ is 1.9 × 10^-13 at 25 °C.

If the ratio of acid to base in a buffer is increased by a factor of 10,the buffer pH decreases by ________.

A 5.0 × 10^-4 M solution of MnSO₄ is gradually made more basic by adding NaOH.At what pH will manganese(II) hydroxide begin to precipitate? The K_sp of Mn(OH) ₂ is 2.0 × 10^-13 and K_w = 1.01 × 10^-14.

Consider the reaction Cu²⁺(aq) + 4 NH₃(aq) Cu(NH₃) ₄²⁺(aq) K_f = 2.1 × 10¹³ If the K_sp for Cu(OH) ₂ is 2.2 × 10^-20,what is the value of the equilibrium constant,K,for the reaction below? Cu(NH₃) ₄²⁺(aq) + 2 OH^-(aq) Cu(OH) ₂(s) + 4 NH₃(aq)

Given the two equilibria below, Ag(NH₃) ₂⁺(aq) Ag⁺(aq) + 2NH₃(aq) ; K_d = 5.9 × 10^-8 AgCN(s) Ag⁺(aq) + CN−(aq) ; K_sp = what is K for the following equilibrium? AgCN(s) + 2NH₃(aq) Ag(NH₃) ₂⁺(aq) + CN^-(aq)

What is the concentration of Cd²⁺(aq) in a mixture of 0.014 mol Cd(NO₃) ₂ and 1.0 mol NH₃ diluted to 1.00 L? For Cd(NH₃) ₄²⁺,K_f = 1.0 × 10⁷.

Suppose 50.00 mL of 2.0 × 10^-5 M Fe(NO₃) ₃ is added to 50.00 mL of 2.0 ×10^-4 M KIO₃.Which of the following statements is true? For Fe(IO₃) ₃,K_sp = 1.0 × 10^-14.

The concentration of Pb²⁺ in an aqueous solution is 5.5 × 10^-3 M.What concentration of SO₄^2- is required to begin precipitating PbSO₄? The K_sp of PbSO₄ is 2.5 × 10^-8.

Given the following reactions, AgBr(s) Ag⁺(aq) + Br^-(aq) K_sp = 5.4 × 10^-13 Ag⁺(aq) + 2 CN^-(aq) Ag(CN) ₂^-(aq) K_f = 1.2 × 10²¹ Determine the equilibrium constant for the reaction below. AgBr(s) + 2 CN^-(aq) Ag(CN) ₂^-(aq) + Br^-(aq)

Calculate the molar concentration of uncomplexed Zn²⁺(aq) in a solution that contains 0.17 M Zn(NH₃) ₄²⁺ and 0.3775 M NH₃ at equilibrium.K_f for Zn(NH₃) ₄²⁺ is .

What is the value of the dissociation constant,K_dissociation,for the complex ion Zn(NH₃) ₄²⁺? (K_f = 2.9 × 10⁹)

If 500 mL of 1.4 × 10^-6 M AgNO₃ is mixed with 500 mL of 1.4 × 10^-6 M NaBr,what will occur? For AgBr,K_sp = 5 × 10^-13.

What is the maximum hydroxide-ion concentration that a 0.019 M MgCl₂ solution could have without causing the precipitation of Mg(OH) ₂? For Mg(OH) ₂,K_sp = 1.8 × 10^-11.

For a monoprotic acid titration,the _____ in a titration is the point where number of moles of a strong base added equals the number of moles of an acid initially present.

What is the minimum concentration of Cd²⁺ required to begin precipitating Cd(OH) ₂(s) in a solution buffered at pH 10.83? The K_sp of Cd(OH) ₂ is 5.3 × 10^-15 and K_w = 1.01 × 10^-14.

Quiz 17: Principles of Chemical Reactivity: Other Aspects of Aqueous Equilibria

In which of the following solutions would silver(I) phosphate,Ag3PO4,be least soluble?

What is the minimum mass of Na2CO3 (molar mass = 105.990 g/mol) that must be added to 43.4 mL of a 1.0 × 10-4 M AgNO3 solution in order for precipitation to occur? The Ksp of Ag2CO3 is 8.6 × 10-12.Assume no volume change occurs upon addition of Na2CO3.

​Given the following equilibrium constants, Zn4IO3) 2 Ksp = Zn(NH3) 42+ Kf = determine K for the dissolution of the sparingly soluble salt Zn(IO3) 2 in aqueous ammonia (shown below) . Zn(IO3) 2(s) + 4NH3(aq) ⇌ Zn(NH3) 42+(aq) + 2IO3-(aq)

Two important biological buffer systems control pH in the range of 6.9 to 7.4.These buffer systems are H2CO3/HCO3- and _____.

What is the molar solubility of Mn(OH) 2(s) in a solution that is buffered at pH 8.00 at 25 °C? The Ksp of Mn(OH) 2 is 1.9 × 10-13 at 25 °C.

If the ratio of acid to base in a buffer is increased by a factor of 10,the buffer pH decreases by ________.

A 5.0 × 10-4 M solution of MnSO4 is gradually made more basic by adding NaOH.At what pH will manganese(II) hydroxide begin to precipitate? The Ksp of Mn(OH) 2 is 2.0 × 10-13 and Kw = 1.01 × 10-14.

Consider the reaction Cu2+(aq) + 4 NH3(aq) Cu(NH3) 42+(aq) Kf = 2.1 × 1013 If the Ksp for Cu(OH) 2 is 2.2 × 10-20,what is the value of the equilibrium constant,K,for the reaction below? Cu(NH3) 42+(aq) + 2 OH-(aq) Cu(OH) 2(s) + 4 NH3(aq)

Given the two equilibria below, Ag(NH3) 2+(aq) Ag+(aq) + 2NH3(aq) ; Kd = 5.9 × 10-8 AgCN(s) Ag+(aq) + CN−(aq) ; Ksp = what is K for the following equilibrium? AgCN(s) + 2NH3(aq) Ag(NH3) 2+(aq) + CN-(aq)

What is the concentration of Cd2+(aq) in a mixture of 0.014 mol Cd(NO3) 2 and 1.0 mol NH3 diluted to 1.00 L? For Cd(NH3) 42+,Kf = 1.0 × 107.​

Suppose 50.00 mL of 2.0 × 10-5 M Fe(NO3) 3 is added to 50.00 mL of 2.0 ×10-4 M KIO3.Which of the following statements is true? For Fe(IO3) 3,Ksp = 1.0 × 10-14.

The concentration of Pb2+ in an aqueous solution is 5.5 × 10-3 M.What concentration of SO42- is required to begin precipitating PbSO4? The Ksp of PbSO4 is 2.5 × 10-8.

An aqueous solution contains 0.010 M bromide ion (Br-) and 0.010 M iodide ion (I-) .If silver ions (Ag+) are added to the solution until silver bromide just begins to precipitate,what are the concentrations of silver ions and iodide ions? (Ksp of AgBr = 5.4 × 10-13 and Ksp of AgI = 8.5 × 10-17)

Given the following reactions, AgBr(s) Ag+(aq) + Br-(aq) Ksp = 5.4 × 10-13 Ag+(aq) + 2 CN-(aq) Ag(CN) 2-(aq) Kf = 1.2 × 1021 Determine the equilibrium constant for the reaction below. AgBr(s) + 2 CN-(aq) Ag(CN) 2-(aq) + Br-(aq)

Calculate the molar concentration of uncomplexed Zn2+(aq) in a solution that contains 0.17 M Zn(NH3) 42+ and 0.3775 M NH3 at equilibrium.Kf for Zn(NH3) 42+ is .

What is the value of the dissociation constant,Kdissociation,for the complex ion Zn(NH3) 42+? (Kf = 2.9 × 109)

If 500 mL of 1.4 × 10-6 M AgNO3 is mixed with 500 mL of 1.4 × 10-6 M NaBr,what will occur? For AgBr,Ksp = 5 × 10-13.

What is the maximum hydroxide-ion concentration that a 0.019 M MgCl2 solution could have without causing the precipitation of Mg(OH) 2? For Mg(OH) 2,Ksp = 1.8 × 10-11.

For a monoprotic acid titration,the _____ in a titration is the point where number of moles of a strong base added equals the number of moles of an acid initially present.

What is the minimum concentration of Cd2+ required to begin precipitating Cd(OH) 2(s) in a solution buffered at pH 10.83? The Ksp of Cd(OH) 2 is 5.3 × 10-15 and Kw = 1.01 × 10-14.

In which of the following solutions would silver(I) phosphate,Ag₃PO₄,be least soluble?

What is the minimum mass of Na₂CO₃ (molar mass = 105.990 g/mol) that must be added to 43.4 mL of a 1.0 × 10^-4 M AgNO₃ solution in order for precipitation to occur? The K_sp of Ag₂CO₃ is 8.6 × 10^-12.Assume no volume change occurs upon addition of Na₂CO₃.

Given the following equilibrium constants, Zn4IO₃) ₂ K_sp = Zn(NH₃) ₄²⁺ K_f = determine K for the dissolution of the sparingly soluble salt Zn(IO₃) ₂ in aqueous ammonia (shown below) . Zn(IO₃) ₂(s) + 4NH₃(aq) ⇌ Zn(NH₃) ₄²⁺(aq) + 2IO₃^-(aq)

Two important biological buffer systems control pH in the range of 6.9 to 7.4.These buffer systems are H₂CO₃/HCO₃^- and _____.

What is the molar solubility of Mn(OH) ₂(s) in a solution that is buffered at pH 8.00 at 25 °C? The K_sp of Mn(OH) ₂ is 1.9 × 10^-13 at 25 °C.

A 5.0 × 10^-4 M solution of MnSO₄ is gradually made more basic by adding NaOH.At what pH will manganese(II) hydroxide begin to precipitate? The K_sp of Mn(OH) ₂ is 2.0 × 10^-13 and K_w = 1.01 × 10^-14.

Consider the reaction Cu²⁺(aq) + 4 NH₃(aq) Cu(NH₃) ₄²⁺(aq) K_f = 2.1 × 10¹³ If the K_sp for Cu(OH) ₂ is 2.2 × 10^-20,what is the value of the equilibrium constant,K,for the reaction below? Cu(NH₃) ₄²⁺(aq) + 2 OH^-(aq) Cu(OH) ₂(s) + 4 NH₃(aq)

Given the two equilibria below, Ag(NH₃) ₂⁺(aq) Ag⁺(aq) + 2NH₃(aq) ; K_d = 5.9 × 10^-8 AgCN(s) Ag⁺(aq) + CN−(aq) ; K_sp = what is K for the following equilibrium? AgCN(s) + 2NH₃(aq) Ag(NH₃) ₂⁺(aq) + CN^-(aq)

What is the concentration of Cd²⁺(aq) in a mixture of 0.014 mol Cd(NO₃) ₂ and 1.0 mol NH₃ diluted to 1.00 L? For Cd(NH₃) ₄²⁺,K_f = 1.0 × 10⁷.

Suppose 50.00 mL of 2.0 × 10^-5 M Fe(NO₃) ₃ is added to 50.00 mL of 2.0 ×10^-4 M KIO₃.Which of the following statements is true? For Fe(IO₃) ₃,K_sp = 1.0 × 10^-14.

The concentration of Pb²⁺ in an aqueous solution is 5.5 × 10^-3 M.What concentration of SO₄^2- is required to begin precipitating PbSO₄? The K_sp of PbSO₄ is 2.5 × 10^-8.

Given the following reactions, AgBr(s) Ag⁺(aq) + Br^-(aq) K_sp = 5.4 × 10^-13 Ag⁺(aq) + 2 CN^-(aq) Ag(CN) ₂^-(aq) K_f = 1.2 × 10²¹ Determine the equilibrium constant for the reaction below. AgBr(s) + 2 CN^-(aq) Ag(CN) ₂^-(aq) + Br^-(aq)

Calculate the molar concentration of uncomplexed Zn²⁺(aq) in a solution that contains 0.17 M Zn(NH₃) ₄²⁺ and 0.3775 M NH₃ at equilibrium.K_f for Zn(NH₃) ₄²⁺ is .

What is the value of the dissociation constant,K_dissociation,for the complex ion Zn(NH₃) ₄²⁺? (K_f = 2.9 × 10⁹)

If 500 mL of 1.4 × 10^-6 M AgNO₃ is mixed with 500 mL of 1.4 × 10^-6 M NaBr,what will occur? For AgBr,K_sp = 5 × 10^-13.

What is the maximum hydroxide-ion concentration that a 0.019 M MgCl₂ solution could have without causing the precipitation of Mg(OH) ₂? For Mg(OH) ₂,K_sp = 1.8 × 10^-11.

What is the minimum concentration of Cd²⁺ required to begin precipitating Cd(OH) ₂(s) in a solution buffered at pH 10.83? The K_sp of Cd(OH) ₂ is 5.3 × 10^-15 and K_w = 1.01 × 10^-14.